Products 2918912-98-6
CAS 2918912-98-6 is the registry number for 4-(2-Bromophenoxy)-1-chloro-2-methylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
4-(2-bromophenoxy)-1-chloro-2-methylbenzene (CAS 2918912-98-6) is a chemical compound with the molecular formula C13H10BrClO and a molecular weight of 297.57 g/mol. IUPAC name: 4-(2-bromophenoxy)-1-chloro-2-methylbenzene. InChIKey: BFQQSKSNGNXPCD-UHFFFAOYSA-N.
| Molecular formula | C13H10BrClO |
|---|---|
| Molecular weight | 297.57 g/mol |
| IUPAC name | 4-(2-bromophenoxy)-1-chloro-2-methylbenzene |
| InChIKey | BFQQSKSNGNXPCD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC2=CC=CC=C2Br)Cl |
Computed by PubChem (NCBI)