CAS 2918931-89-0 is the registry number for 1-(4-chloro-2-methoxyphenyl)-4,4-dimethylcyclohexanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-chloro-2-methoxyphenyl)-4,4-dimethylcyclohexan-1-ol (CAS 2918931-89-0) is a chemical compound with the molecular formula C15H21ClO2 and a molecular weight of 268.78 g/mol. IUPAC name: 1-(4-chloro-2-methoxyphenyl)-4,4-dimethylcyclohexan-1-ol. InChIKey: SQBWDIBSNNCORS-UHFFFAOYSA-N.
| Molecular formula | C15H21ClO2 |
|---|---|
| Molecular weight | 268.78 g/mol |
| IUPAC name | 1-(4-chloro-2-methoxyphenyl)-4,4-dimethylcyclohexan-1-ol |
| InChIKey | SQBWDIBSNNCORS-UHFFFAOYSA-N |
| SMILES | CC1(CCC(CC1)(C2=C(C=C(C=C2)Cl)OC)O)C |
Computed by PubChem (NCBI)