CAS 2918951-05-8 is the registry number for 1-bromo-3-cyclohexyl-5-(1,1-dimethylethyl)-Benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
1-bromo-3-tert-butyl-5-cyclohexylbenzene (CAS 2918951-05-8) is a chemical compound with the molecular formula C16H23Br and a molecular weight of 295.26 g/mol. IUPAC name: 1-bromo-3-tert-butyl-5-cyclohexylbenzene. InChIKey: WGIVBUKBAWMHKQ-UHFFFAOYSA-N.
| Molecular formula | C16H23Br |
|---|---|
| Molecular weight | 295.26 g/mol |
| IUPAC name | 1-bromo-3-tert-butyl-5-cyclohexylbenzene |
| InChIKey | WGIVBUKBAWMHKQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C2CCCCC2)Br |
Computed by PubChem (NCBI)