Products 2918957-12-5
CAS 2918957-12-5 is the registry number for 1-bromo-2-chloro-3-((4-methoxybenzyl)oxy)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2-chloro-3-[(4-methoxyphenyl)methoxy]benzene (CAS 2918957-12-5) is a chemical compound with the molecular formula C14H12BrClO2 and a molecular weight of 327.60 g/mol. IUPAC name: 1-bromo-2-chloro-3-[(4-methoxyphenyl)methoxy]benzene. InChIKey: AUMGHWFVUROOIY-UHFFFAOYSA-N.
| Molecular formula | C14H12BrClO2 |
|---|---|
| Molecular weight | 327.60 g/mol |
| IUPAC name | 1-bromo-2-chloro-3-[(4-methoxyphenyl)methoxy]benzene |
| InChIKey | AUMGHWFVUROOIY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)COC2=C(C(=CC=C2)Br)Cl |
Computed by PubChem (NCBI)