CAS 2918957-29-4 is the registry number for 2,4,6-tribromo-3-isopropylaniline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,4,6-tribromo-3-propan-2-ylaniline (CAS 2918957-29-4) is a chemical compound with the molecular formula C9H10Br3N and a molecular weight of 371.89 g/mol. IUPAC name: 2,4,6-tribromo-3-propan-2-ylaniline. InChIKey: KZOPJCQMADQPKD-UHFFFAOYSA-N.
| Molecular formula | C9H10Br3N |
|---|---|
| Molecular weight | 371.89 g/mol |
| IUPAC name | 2,4,6-tribromo-3-propan-2-ylaniline |
| InChIKey | KZOPJCQMADQPKD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=C(C=C1Br)Br)N)Br |
Computed by PubChem (NCBI)