Products 2918959-67-6
CAS 2918959-67-6 is the registry number for 2,4-difluoro-5-iodo-3-isopropoxybenzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,4-difluoro-5-iodo-3-propan-2-yloxybenzaldehyde (CAS 2918959-67-6) is a chemical compound with the molecular formula C10H9F2IO2 and a molecular weight of 326.08 g/mol. IUPAC name: 2,4-difluoro-5-iodo-3-propan-2-yloxybenzaldehyde. InChIKey: SDTFYSMGCLPQBC-UHFFFAOYSA-N.
| Molecular formula | C10H9F2IO2 |
|---|---|
| Molecular weight | 326.08 g/mol |
| IUPAC name | 2,4-difluoro-5-iodo-3-propan-2-yloxybenzaldehyde |
| InChIKey | SDTFYSMGCLPQBC-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C(=CC(=C1F)I)C=O)F |
Computed by PubChem (NCBI)