CAS 2918960-88-8 is the registry number for (2,3-difluoro-6-(methylthio)phenyl)trimethylsilane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2,3-difluoro-6-methylsulfanylphenyl)-trimethylsilane (CAS 2918960-88-8) is a chemical compound with the molecular formula C10H14F2SSi and a molecular weight of 232.37 g/mol. IUPAC name: (2,3-difluoro-6-methylsulfanylphenyl)-trimethylsilane. InChIKey: DVGNEJMSJZBQPS-UHFFFAOYSA-N.
| Molecular formula | C10H14F2SSi |
|---|---|
| Molecular weight | 232.37 g/mol |
| IUPAC name | (2,3-difluoro-6-methylsulfanylphenyl)-trimethylsilane |
| InChIKey | DVGNEJMSJZBQPS-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C=CC(=C1F)F)SC |
Computed by PubChem (NCBI)