CAS 2918963-52-5 is the registry number for 5-bromo-8-fluoro-7-iodoquinoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-bromo-8-fluoro-7-iodoquinoline (CAS 2918963-52-5) is a chemical compound with the molecular formula C9H4BrFIN and a molecular weight of 351.94 g/mol. IUPAC name: 5-bromo-8-fluoro-7-iodoquinoline. InChIKey: NVPZFSWQYZAJFI-UHFFFAOYSA-N.
| Molecular formula | C9H4BrFIN |
|---|---|
| Molecular weight | 351.94 g/mol |
| IUPAC name | 5-bromo-8-fluoro-7-iodoquinoline |
| InChIKey | NVPZFSWQYZAJFI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C(C=C2Br)I)F)N=C1 |
Computed by PubChem (NCBI)