CAS 2918969-27-2 is the registry number for 1,5-dibromo-2-methoxy-4-(methylsulfonyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,5-dibromo-2-methoxy-4-methylsulfonylbenzene (CAS 2918969-27-2) is a chemical compound with the molecular formula C8H8Br2O3S and a molecular weight of 344.02 g/mol. IUPAC name: 1,5-dibromo-2-methoxy-4-methylsulfonylbenzene. InChIKey: GDRMTKCLMGBQNP-UHFFFAOYSA-N.
| Molecular formula | C8H8Br2O3S |
|---|---|
| Molecular weight | 344.02 g/mol |
| IUPAC name | 1,5-dibromo-2-methoxy-4-methylsulfonylbenzene |
| InChIKey | GDRMTKCLMGBQNP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1Br)Br)S(=O)(=O)C |
Computed by PubChem (NCBI)