CAS 2918970-06-4 is the registry number for (Z)-ethyl 3-(2,5-difluorophenyl)-4,4-difluorobut-2-enoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl (Z)-3-(2,5-difluorophenyl)-4,4-difluorobut-2-enoate (CAS 2918970-06-4) is a chemical compound with the molecular formula C12H10F4O2 and a molecular weight of 262.20 g/mol. IUPAC name: ethyl (Z)-3-(2,5-difluorophenyl)-4,4-difluorobut-2-enoate. InChIKey: AALXCDGJNPKDGX-TWGQIWQCSA-N.
| Molecular formula | C12H10F4O2 |
|---|---|
| Molecular weight | 262.20 g/mol |
| IUPAC name | ethyl (Z)-3-(2,5-difluorophenyl)-4,4-difluorobut-2-enoate |
| InChIKey | AALXCDGJNPKDGX-TWGQIWQCSA-N |
| SMILES | CCOC(=O)/C=C(/C1=C(C=CC(=C1)F)F)\C(F)F |
Computed by PubChem (NCBI)