CAS 2919490-00-7 is the registry number for rel-1-((3R,4S)-3-Amino-4-fluoropyrrolidin-1-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(3R,4S)-3-amino-4-fluoropyrrolidin-1-yl]ethanone (CAS 2919490-00-7) is a chemical compound with the molecular formula C6H11FN2O and a molecular weight of 146.16 g/mol. IUPAC name: 1-[(3R,4S)-3-amino-4-fluoropyrrolidin-1-yl]ethanone. InChIKey: XPOYUVJCFNVBBA-NTSWFWBYSA-N.
| Molecular formula | C6H11FN2O |
|---|---|
| Molecular weight | 146.16 g/mol |
| IUPAC name | 1-[(3R,4S)-3-amino-4-fluoropyrrolidin-1-yl]ethanone |
| InChIKey | XPOYUVJCFNVBBA-NTSWFWBYSA-N |
| SMILES | CC(=O)N1C[C@H]([C@H](C1)F)N |
Computed by PubChem (NCBI)