Products 2919766-97-3

CAS 2919766-97-3 is the registry number for HDAC11-IN-2, 99.52%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 50 mg, 10mM/1mL, 100 mg, 5 mg.

Structural formula: {0} (CAS {1})

N-[[4-[(5-pentoxypentylamino)carbamoyl]phenyl]methyl]benzamide (CAS 2919766-97-3) is a chemical compound with the molecular formula C25H35N3O3 and a molecular weight of 425.6 g/mol. IUPAC name: N-[[4-[(5-pentoxypentylamino)carbamoyl]phenyl]methyl]benzamide. InChIKey: JQMPXWWDCDMIEL-UHFFFAOYSA-N.

Identity
Molecular formulaC25H35N3O3
Molecular weight425.6 g/mol
IUPAC nameN-[[4-[(5-pentoxypentylamino)carbamoyl]phenyl]methyl]benzamide
InChIKeyJQMPXWWDCDMIEL-UHFFFAOYSA-N
SMILESCCCCCOCCCCCNNC(=O)C1=CC=C(C=C1)CNC(=O)C2=CC=CC=C2

Computed by PubChem (NCBI)