CAS 29199-61-9 is the registry number for 2-((2,6-Dimethylphenyl)amino)-N,N-diethyl-N-methyl-2-oxoethanaminium iodide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-methylazanium chloride (CAS 29199-61-9) is a chemical compound with the molecular formula C15H25ClN2O and a molecular weight of 284.82 g/mol. IUPAC name: [2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-methylazanium chloride. InChIKey: DGCSRAPAKCHQIA-UHFFFAOYSA-N.
| Molecular formula | C15H25ClN2O |
|---|---|
| Molecular weight | 284.82 g/mol |
| IUPAC name | [2-(2,6-dimethylanilino)-2-oxoethyl]-diethyl-methylazanium chloride |
| InChIKey | DGCSRAPAKCHQIA-UHFFFAOYSA-N |
| SMILES | CC[N+](C)(CC)CC(=O)NC1=C(C=CC=C1C)C.[Cl-] |
Computed by PubChem (NCBI)