Products 2920220-00-2
CAS 2920220-00-2 is the registry number for 6-[(1R)-1-aminoethyl]-4-(trifluoromethyl)pyridin-2-amine,dihydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6-[(1R)-1-aminoethyl]-4-(trifluoromethyl)pyridin-2-amine;dihydrochloride (CAS 2920220-00-2) is a chemical compound with the molecular formula C8H12Cl2F3N3 and a molecular weight of 278.10 g/mol. IUPAC name: 6-[(1R)-1-aminoethyl]-4-(trifluoromethyl)pyridin-2-amine;dihydrochloride. InChIKey: UOCMNJVICUNQNZ-RZFWHQLPSA-N.
| Molecular formula | C8H12Cl2F3N3 |
|---|---|
| Molecular weight | 278.10 g/mol |
| IUPAC name | 6-[(1R)-1-aminoethyl]-4-(trifluoromethyl)pyridin-2-amine;dihydrochloride |
| InChIKey | UOCMNJVICUNQNZ-RZFWHQLPSA-N |
| SMILES | C[C@H](C1=NC(=CC(=C1)C(F)(F)F)N)N.Cl.Cl |
Computed by PubChem (NCBI)