CAS 2920231-88-3 is the registry number for tert-butyl (4aS,7aS)-7-oxo-3,4,4a,5,6,7a-hexahydro-1H-cyclopenta[c]pyridine-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (4aS,7aS)-7-oxo-3,4,4a,5,6,7a-hexahydro-1H-cyclopenta[c]pyridine-2-carboxylate (CAS 2920231-88-3) is a chemical compound with the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. IUPAC name: tert-butyl (4aS,7aS)-7-oxo-3,4,4a,5,6,7a-hexahydro-1H-cyclopenta[c]pyridine-2-carboxylate. InChIKey: PBVSLRZFMAPLDV-VHSXEESVSA-N.
| Molecular formula | C13H21NO3 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | tert-butyl (4aS,7aS)-7-oxo-3,4,4a,5,6,7a-hexahydro-1H-cyclopenta[c]pyridine-2-carboxylate |
| InChIKey | PBVSLRZFMAPLDV-VHSXEESVSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2CCC(=O)[C@@H]2C1 |
Computed by PubChem (NCBI)