Products 2920233-12-9
CAS 2920233-12-9 is the registry number for [(1R,3S,5R)-5-methyl-2-azabicyclo[3.1.0]hexan-3-yl]methanol,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
[(1R,3S,5R)-5-methyl-2-azabicyclo[3.1.0]hexan-3-yl]methanol;hydrochloride (CAS 2920233-12-9) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: [(1R,3S,5R)-5-methyl-2-azabicyclo[3.1.0]hexan-3-yl]methanol;hydrochloride. InChIKey: XHPHJXUNKRXLPH-UHRUZOLSSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | [(1R,3S,5R)-5-methyl-2-azabicyclo[3.1.0]hexan-3-yl]methanol;hydrochloride |
| InChIKey | XHPHJXUNKRXLPH-UHRUZOLSSA-N |
| SMILES | C[C@@]12C[C@H](N[C@@H]1C2)CO.Cl |
Computed by PubChem (NCBI)