CAS 2920238-96-4 is the registry number for Methyl (R)-3-(4-bromothiazol-2-yl)-2-((tert-butoxycarbonyl)amino)propanoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl (2R)-3-(4-bromo-1,3-thiazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 2920238-96-4) is a chemical compound with the molecular formula C12H17BrN2O4S and a molecular weight of 365.25 g/mol. IUPAC name: methyl (2R)-3-(4-bromo-1,3-thiazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: XOHKCICGHIWNNO-SSDOTTSWSA-N.
| Molecular formula | C12H17BrN2O4S |
|---|---|
| Molecular weight | 365.25 g/mol |
| IUPAC name | methyl (2R)-3-(4-bromo-1,3-thiazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | XOHKCICGHIWNNO-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=NC(=CS1)Br)C(=O)OC |
Computed by PubChem (NCBI)