CAS 2920239-36-5 appears in our catalog under these names: (2S,4S)-1-(tert-Butoxycarbonyl)-4-methylazetidine-2-carboxylic acid, 98%, (2S,4S)-1-(tert-butoxycarbonyl)-4-methylazetidine-2-carboxylic acid, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 500mg.
(2S,4S)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid (CAS 2920239-36-5) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: (2S,4S)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid. InChIKey: SZFDJSLFSMVIOM-BQBZGAKWSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | (2S,4S)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid |
| InChIKey | SZFDJSLFSMVIOM-BQBZGAKWSA-N |
| SMILES | C[C@H]1C[C@H](N1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)