CAS 2920304-61-4 is the registry number for rel-(1R,5S,6R)-3,3-difluorobicyclo[3.1.0]hexane-6-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,5R)-3,3-difluorobicyclo[3.1.0]hexane-6-carbaldehyde (CAS 2920304-61-4) is a chemical compound with the molecular formula C7H8F2O and a molecular weight of 146.13 g/mol. IUPAC name: (1S,5R)-3,3-difluorobicyclo[3.1.0]hexane-6-carbaldehyde. InChIKey: MTSATSZAVIKUEO-XEAPYIEGSA-N.
| Molecular formula | C7H8F2O |
|---|---|
| Molecular weight | 146.13 g/mol |
| IUPAC name | (1S,5R)-3,3-difluorobicyclo[3.1.0]hexane-6-carbaldehyde |
| InChIKey | MTSATSZAVIKUEO-XEAPYIEGSA-N |
| SMILES | C1[C@@H]2[C@@H](C2C=O)CC1(F)F |
Computed by PubChem (NCBI)