CAS 2920305-42-4 is the registry number for (R)-2-(((R)-1,1,1-Trifluoropropan-2-yl)oxy)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[(2R)-1,1,1-trifluoropropan-2-yl]oxypropanoic acid (CAS 2920305-42-4) is a chemical compound with the molecular formula C6H9F3O3 and a molecular weight of 186.13 g/mol. IUPAC name: (2R)-2-[(2R)-1,1,1-trifluoropropan-2-yl]oxypropanoic acid. InChIKey: NLIPDMMTPOKCGP-QWWZWVQMSA-N.
| Molecular formula | C6H9F3O3 |
|---|---|
| Molecular weight | 186.13 g/mol |
| IUPAC name | (2R)-2-[(2R)-1,1,1-trifluoropropan-2-yl]oxypropanoic acid |
| InChIKey | NLIPDMMTPOKCGP-QWWZWVQMSA-N |
| SMILES | C[C@H](C(=O)O)O[C@H](C)C(F)(F)F |
Computed by PubChem (NCBI)