Products 2920446-04-2
CAS 2920446-04-2 is the registry number for (2S)-1-(3,8-diazabicyclo[3.2.1]octan-3-yl)propan-2-ol, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(2S)-1-(3,8-diazabicyclo[3.2.1]octan-3-yl)propan-2-ol (CAS 2920446-04-2) is a chemical compound with the molecular formula C9H18N2O and a molecular weight of 170.25 g/mol. IUPAC name: (2S)-1-(3,8-diazabicyclo[3.2.1]octan-3-yl)propan-2-ol. InChIKey: QODUIPLRMQIEEB-UEJVZZJDSA-N.
| Molecular formula | C9H18N2O |
|---|---|
| Molecular weight | 170.25 g/mol |
| IUPAC name | (2S)-1-(3,8-diazabicyclo[3.2.1]octan-3-yl)propan-2-ol |
| InChIKey | QODUIPLRMQIEEB-UEJVZZJDSA-N |
| SMILES | C[C@@H](CN1CC2CCC(C1)N2)O |
Computed by PubChem (NCBI)