CAS 292074-84-1 is the registry number for N-(4-(Benzo[d]thiazol-2-yl)phenyl)-2-(2-chlorophenoxy)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-(1,3-benzothiazol-2-yl)phenyl]-2-(2-chlorophenoxy)acetamide (CAS 292074-84-1) is a chemical compound with the molecular formula C21H15ClN2O2S and a molecular weight of 394.9 g/mol. IUPAC name: N-[4-(1,3-benzothiazol-2-yl)phenyl]-2-(2-chlorophenoxy)acetamide. InChIKey: VKNHUJFWOVRCRK-UHFFFAOYSA-N.
| Molecular formula | C21H15ClN2O2S |
|---|---|
| Molecular weight | 394.9 g/mol |
| IUPAC name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-2-(2-chlorophenoxy)acetamide |
| InChIKey | VKNHUJFWOVRCRK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C3=CC=C(C=C3)NC(=O)COC4=CC=CC=C4Cl |
Computed by PubChem (NCBI)