Products 2920763-86-4

CAS 2920763-86-4 is the registry number for Di-tert-butyl 5-oxopiperazine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Ditert-butyl 5-oxopiperazine-1,2-dicarboxylate (CAS 2920763-86-4) is a chemical compound with the molecular formula C14H24N2O5 and a molecular weight of 300.35 g/mol. IUPAC name: ditert-butyl 5-oxopiperazine-1,2-dicarboxylate. InChIKey: FKPMFGLUEXFWGU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H24N2O5
Molecular weight300.35 g/mol
IUPAC nameditert-butyl 5-oxopiperazine-1,2-dicarboxylate
InChIKeyFKPMFGLUEXFWGU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1CNC(=O)CN1C(=O)OC(C)(C)C

Computed by PubChem (NCBI)