CAS 292077-80-6 is the registry number for N'-(2-Chloro-6-fluorobenzylidene)-4-methylbenzenesulfonohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-4-methylbenzenesulfonamide (CAS 292077-80-6) is a chemical compound with the molecular formula C14H12ClFN2O2S and a molecular weight of 326.8 g/mol. IUPAC name: N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-4-methylbenzenesulfonamide. InChIKey: JZCIBHAOAAKHKD-RQZCQDPDSA-N.
| Molecular formula | C14H12ClFN2O2S |
|---|---|
| Molecular weight | 326.8 g/mol |
| IUPAC name | N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | JZCIBHAOAAKHKD-RQZCQDPDSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=C(C=CC=C2Cl)F |
Computed by PubChem (NCBI)