CAS 292165-42-5 is the registry number for 4-Bromo-N,N-dimethylbenzene-1-carboximidamide hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-bromo-N,N-dimethylbenzenecarboximidamide;hydrochloride (CAS 292165-42-5) is a chemical compound with the molecular formula C9H12BrClN2 and a molecular weight of 263.56 g/mol. IUPAC name: 4-bromo-N,N-dimethylbenzenecarboximidamide;hydrochloride. InChIKey: HEOQDHPRTYJMNX-UHFFFAOYSA-N.
| Molecular formula | C9H12BrClN2 |
|---|---|
| Molecular weight | 263.56 g/mol |
| IUPAC name | 4-bromo-N,N-dimethylbenzenecarboximidamide;hydrochloride |
| InChIKey | HEOQDHPRTYJMNX-UHFFFAOYSA-N |
| SMILES | CN(C)C(=N)C1=CC=C(C=C1)Br.Cl |
Computed by PubChem (NCBI)