Products 2921685-98-3
CAS 2921685-98-3 is the registry number for Ethyl 2-amino-3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-amino-3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2921685-98-3) is a chemical compound with the molecular formula C15H21BFNO4 and a molecular weight of 309.14 g/mol. IUPAC name: ethyl 2-amino-3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: CITOXCZTPGVVCL-UHFFFAOYSA-N.
| Molecular formula | C15H21BFNO4 |
|---|---|
| Molecular weight | 309.14 g/mol |
| IUPAC name | ethyl 2-amino-3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | CITOXCZTPGVVCL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)C(=O)OCC)N)F |
Computed by PubChem (NCBI)