CAS 2921757-44-8 is the registry number for 2-chloro-1-(2,3-dibromo-6-fluorophenyl)-2,2-difluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-1-(2,3-dibromo-6-fluorophenyl)-2,2-difluoroethanone (CAS 2921757-44-8) is a chemical compound with the molecular formula C8H2Br2ClF3O and a molecular weight of 366.35 g/mol. IUPAC name: 2-chloro-1-(2,3-dibromo-6-fluorophenyl)-2,2-difluoroethanone. InChIKey: HQBFWDKVNJTQLT-UHFFFAOYSA-N.
| Molecular formula | C8H2Br2ClF3O |
|---|---|
| Molecular weight | 366.35 g/mol |
| IUPAC name | 2-chloro-1-(2,3-dibromo-6-fluorophenyl)-2,2-difluoroethanone |
| InChIKey | HQBFWDKVNJTQLT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)C(F)(F)Cl)Br)Br |
Computed by PubChem (NCBI)