CAS 2921863-76-3 is the registry number for 3-(2-bromo-4-(trifluoromethoxy)phenyl)thiophene, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
3-[2-bromo-4-(trifluoromethoxy)phenyl]thiophene (CAS 2921863-76-3) is a chemical compound with the molecular formula C11H6BrF3OS and a molecular weight of 323.13 g/mol. IUPAC name: 3-[2-bromo-4-(trifluoromethoxy)phenyl]thiophene. InChIKey: PMCHZANIXHKQGD-UHFFFAOYSA-N.
| Molecular formula | C11H6BrF3OS |
|---|---|
| Molecular weight | 323.13 g/mol |
| IUPAC name | 3-[2-bromo-4-(trifluoromethoxy)phenyl]thiophene |
| InChIKey | PMCHZANIXHKQGD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)Br)C2=CSC=C2 |
Computed by PubChem (NCBI)