CAS 2921870-98-4 is the registry number for 1-(benzo[b]thiophen-2-yl)-2-chloro-2,2-difluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(1-benzothiophen-2-yl)-2-chloro-2,2-difluoroethanone (CAS 2921870-98-4) is a chemical compound with the molecular formula C10H5ClF2OS and a molecular weight of 246.66 g/mol. IUPAC name: 1-(1-benzothiophen-2-yl)-2-chloro-2,2-difluoroethanone. InChIKey: ZWTBVJVTMNLAIY-UHFFFAOYSA-N.
| Molecular formula | C10H5ClF2OS |
|---|---|
| Molecular weight | 246.66 g/mol |
| IUPAC name | 1-(1-benzothiophen-2-yl)-2-chloro-2,2-difluoroethanone |
| InChIKey | ZWTBVJVTMNLAIY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2)C(=O)C(F)(F)Cl |
Computed by PubChem (NCBI)