Products 2921879-45-8
CAS 2921879-45-8 is the registry number for 1-(3-bromo-2-chloro-6-fluorophenyl)-2-chloro-2,2-difluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-bromo-2-chloro-6-fluorophenyl)-2-chloro-2,2-difluoroethanone (CAS 2921879-45-8) is a chemical compound with the molecular formula C8H2BrCl2F3O and a molecular weight of 321.90 g/mol. IUPAC name: 1-(3-bromo-2-chloro-6-fluorophenyl)-2-chloro-2,2-difluoroethanone. InChIKey: DORBJIQUDGCMKZ-UHFFFAOYSA-N.
| Molecular formula | C8H2BrCl2F3O |
|---|---|
| Molecular weight | 321.90 g/mol |
| IUPAC name | 1-(3-bromo-2-chloro-6-fluorophenyl)-2-chloro-2,2-difluoroethanone |
| InChIKey | DORBJIQUDGCMKZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)C(F)(F)Cl)Cl)Br |
Computed by PubChem (NCBI)