Products 2921955-00-0

CAS 2921955-00-0 is the registry number for 1-(4-Chlorophenyl)cyclobutane-1-carbonyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(4-chlorophenyl)cyclobutane-1-carbonyl fluoride (CAS 2921955-00-0) is a chemical compound with the molecular formula C11H10ClFO and a molecular weight of 212.65 g/mol. IUPAC name: 1-(4-chlorophenyl)cyclobutane-1-carbonyl fluoride. InChIKey: DGJXVKQXUBHJKX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10ClFO
Molecular weight212.65 g/mol
IUPAC name1-(4-chlorophenyl)cyclobutane-1-carbonyl fluoride
InChIKeyDGJXVKQXUBHJKX-UHFFFAOYSA-N
SMILESC1CC(C1)(C2=CC=C(C=C2)Cl)C(=O)F

Computed by PubChem (NCBI)