CAS 2922-54-5 appears in our catalog under these names: Monosodium succinate, 98%, Sodium 3-carboxypropanoate, 98%, Succinic acid (monosodium), Monosodium Succinate, >98.0%(T), Monosodium succinate. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Biosynth. Available pack sizes: 25g, 1kg, 100g, 500g, 5g, 2kg.
Sodium 4-hydroxy-4-oxobutanoate (CAS 2922-54-5) is a chemical compound with the molecular formula C4H5NaO4 and a molecular weight of 140.07 g/mol. IUPAC name: sodium 4-hydroxy-4-oxobutanoate. InChIKey: KZQSXALQTHVPDQ-UHFFFAOYSA-M.
| Molecular formula | C4H5NaO4 |
|---|---|
| Molecular weight | 140.07 g/mol |
| IUPAC name | sodium 4-hydroxy-4-oxobutanoate |
| InChIKey | KZQSXALQTHVPDQ-UHFFFAOYSA-M |
| SMILES | C(CC(=O)[O-])C(=O)O.[Na+] |
Computed by PubChem (NCBI)