Products 2922283-04-1
CAS 2922283-04-1 is the registry number for (RS)-AMPA (hydrochloride), 98.74%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 25 mg.
2-amino-3-(5-methyl-3-oxo-1,2-oxazol-4-yl)propanoic acid;hydrochloride (CAS 2922283-04-1) is a chemical compound with the molecular formula C7H11ClN2O4 and a molecular weight of 222.62 g/mol. IUPAC name: 2-amino-3-(5-methyl-3-oxo-1,2-oxazol-4-yl)propanoic acid;hydrochloride. InChIKey: CKVBWVWGMKTZAG-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O4 |
|---|---|
| Molecular weight | 222.62 g/mol |
| IUPAC name | 2-amino-3-(5-methyl-3-oxo-1,2-oxazol-4-yl)propanoic acid;hydrochloride |
| InChIKey | CKVBWVWGMKTZAG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NO1)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)