CAS 2922283-79-0 is the registry number for 8-(DIFLUOROMETHYL)QUINOLIN-6-AMINE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
8-(difluoromethyl)quinolin-6-amine (CAS 2922283-79-0) is a chemical compound with the molecular formula C10H8F2N2 and a molecular weight of 194.18 g/mol. IUPAC name: 8-(difluoromethyl)quinolin-6-amine. InChIKey: OBTFFRIESXMFHY-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N2 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 8-(difluoromethyl)quinolin-6-amine |
| InChIKey | OBTFFRIESXMFHY-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)C(F)F)N |
Computed by PubChem (NCBI)