Products 2922291-75-4

CAS 2922291-75-4 is the registry number for rel-(1R,2R)-2-Ethynylcyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Cis-(1R,2R)-2-ethynylcyclopropane-1-carboxylic acid (CAS 2922291-75-4) is a chemical compound with the molecular formula C6H6O2 and a molecular weight of 110.11 g/mol. IUPAC name: cis-(1R,2R)-2-ethynylcyclopropane-1-carboxylic acid. InChIKey: WAOURCILMTVHBE-RFZPGFLSSA-N.

Identity
Molecular formulaC6H6O2
Molecular weight110.11 g/mol
IUPAC namecis-(1R,2R)-2-ethynylcyclopropane-1-carboxylic acid
InChIKeyWAOURCILMTVHBE-RFZPGFLSSA-N
SMILESC#C[C@@H]1C[C@H]1C(=O)O

Computed by PubChem (NCBI)