Products 2922439-58-3
CAS 2922439-58-3 is the registry number for [(1R,3R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]methanol,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
[(1R,3R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]methanol;hydrochloride (CAS 2922439-58-3) is a chemical compound with the molecular formula C6H12ClNO and a molecular weight of 149.62 g/mol. IUPAC name: [(1R,3R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]methanol;hydrochloride. InChIKey: PHCXFCNYKNKCJG-FPKZOZHISA-N.
| Molecular formula | C6H12ClNO |
|---|---|
| Molecular weight | 149.62 g/mol |
| IUPAC name | [(1R,3R,5R)-2-azabicyclo[3.1.0]hexan-3-yl]methanol;hydrochloride |
| InChIKey | PHCXFCNYKNKCJG-FPKZOZHISA-N |
| SMILES | C1[C@H]2C[C@H]2N[C@H]1CO.Cl |
Computed by PubChem (NCBI)