Products 2922502-35-8
CAS 2922502-35-8 is the registry number for 2-(((2R,7AS)-2-fluorotetrahydro-1H-pyrrolizin-7a(5H)-yl)methoxy)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]acetic acid (CAS 2922502-35-8) is a chemical compound with the molecular formula C10H16FNO3 and a molecular weight of 217.24 g/mol. IUPAC name: 2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]acetic acid. InChIKey: XNXNYBIKJHHQBV-SCZZXKLOSA-N.
| Molecular formula | C10H16FNO3 |
|---|---|
| Molecular weight | 217.24 g/mol |
| IUPAC name | 2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]acetic acid |
| InChIKey | XNXNYBIKJHHQBV-SCZZXKLOSA-N |
| SMILES | C1C[C@]2(C[C@H](CN2C1)F)COCC(=O)O |
Computed by PubChem (NCBI)