CAS 2922502-36-9 is the registry number for 2-(((2R,7AS)-2-fluorotetrahydro-1H-pyrrolizin-7a(5H)-yl)methoxy)acetyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]acetyl chloride (CAS 2922502-36-9) is a chemical compound with the molecular formula C10H15ClFNO2 and a molecular weight of 235.68 g/mol. IUPAC name: 2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]acetyl chloride. InChIKey: QVCNZLGZZTXJAN-SCZZXKLOSA-N.
| Molecular formula | C10H15ClFNO2 |
|---|---|
| Molecular weight | 235.68 g/mol |
| IUPAC name | 2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]acetyl chloride |
| InChIKey | QVCNZLGZZTXJAN-SCZZXKLOSA-N |
| SMILES | C1C[C@]2(C[C@H](CN2C1)F)COCC(=O)Cl |
Computed by PubChem (NCBI)