CAS 2922505-77-7 is the registry number for 4,4'-(10-(4'-Amino-[1,1'-Biphenyl]-4-Yl)-10H-Phenothiazine-3,7-Diyl)Dianiline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[4-[3,7-bis(4-aminophenyl)phenothiazin-10-yl]phenyl]aniline (CAS 2922505-77-7) is a chemical compound with the molecular formula C36H28N4S and a molecular weight of 548.7 g/mol. IUPAC name: 4-[4-[3,7-bis(4-aminophenyl)phenothiazin-10-yl]phenyl]aniline. InChIKey: YDQOVCZKUNGUEQ-UHFFFAOYSA-N.
| Molecular formula | C36H28N4S |
|---|---|
| Molecular weight | 548.7 g/mol |
| IUPAC name | 4-[4-[3,7-bis(4-aminophenyl)phenothiazin-10-yl]phenyl]aniline |
| InChIKey | YDQOVCZKUNGUEQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)N3C4=C(C=C(C=C4)C5=CC=C(C=C5)N)SC6=C3C=CC(=C6)C7=CC=C(C=C7)N)N |
Computed by PubChem (NCBI)