CAS 2922814-85-3 is the registry number for NLRP3-IN-81. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(6-cyclopentylsulfonylpyridazin-3-yl)-5-(trifluoromethyl)phenol (CAS 2922814-85-3) is a chemical compound with the molecular formula C16H15F3N2O3S and a molecular weight of 372.4 g/mol. IUPAC name: 2-(6-cyclopentylsulfonylpyridazin-3-yl)-5-(trifluoromethyl)phenol. InChIKey: GTEPLEZLAFGXPB-UHFFFAOYSA-N.
| Molecular formula | C16H15F3N2O3S |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | 2-(6-cyclopentylsulfonylpyridazin-3-yl)-5-(trifluoromethyl)phenol |
| InChIKey | GTEPLEZLAFGXPB-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)S(=O)(=O)C2=NN=C(C=C2)C3=C(C=C(C=C3)C(F)(F)F)O |
Computed by PubChem (NCBI)