CAS 2922884-90-8 is the registry number for ABS-752 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[6-(aminomethyl)-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride (CAS 2922884-90-8) is a chemical compound with the molecular formula C14H15ClFN3O3 and a molecular weight of 327.74 g/mol. IUPAC name: 3-[6-(aminomethyl)-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride. InChIKey: FADPIIXUMZOGAE-UHFFFAOYSA-N.
| Molecular formula | C14H15ClFN3O3 |
|---|---|
| Molecular weight | 327.74 g/mol |
| IUPAC name | 3-[6-(aminomethyl)-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride |
| InChIKey | FADPIIXUMZOGAE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=CC(=C(C=C3C2=O)F)CN.Cl |
Computed by PubChem (NCBI)