CAS 2923-21-9 is the registry number for Perfluoroethanesulfonic acid sodium. Offered by: Dr. Ehrenstorfer. Available pack sizes: 10mg.
Sodium 1,1,2,2,2-pentafluoroethanesulfonate (CAS 2923-21-9) is a chemical compound with the molecular formula C2F5NaO3S and a molecular weight of 222.07 g/mol. IUPAC name: sodium 1,1,2,2,2-pentafluoroethanesulfonate. InChIKey: HSHFKGVNYJYBCJ-UHFFFAOYSA-M.
| Molecular formula | C2F5NaO3S |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | sodium 1,1,2,2,2-pentafluoroethanesulfonate |
| InChIKey | HSHFKGVNYJYBCJ-UHFFFAOYSA-M |
| SMILES | C(C(F)(F)S(=O)(=O)[O-])(F)(F)F.[Na+] |
Computed by PubChem (NCBI)