CAS 2923-26-4 appears in our catalog under these names: Sodium perfluorohexanoate, 95%, Perfluorohexanoic acid sodium, Perfluorohexanoic acid sodium 50 µg/mL in Methanol:Water, Sodium perfluorohexanoate, Sodium 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoate, 95%, 95%. Offered by: Combi-blocks, Dr. Ehrenstorfer, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100mg, 1ml, 2000mg, 1000mg, 5000mg.
Sodium 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoate (CAS 2923-26-4) is a chemical compound with the molecular formula C6F11NaO2 and a molecular weight of 336.03 g/mol. IUPAC name: sodium 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoate. InChIKey: UIMRWXUIVFZGSD-UHFFFAOYSA-M.
| Molecular formula | C6F11NaO2 |
|---|---|
| Molecular weight | 336.03 g/mol |
| IUPAC name | sodium 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoate |
| InChIKey | UIMRWXUIVFZGSD-UHFFFAOYSA-M |
| SMILES | C(=O)(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)[O-].[Na+] |
Computed by PubChem (NCBI)