Products 2923-68-4

CAS 2923-68-4 appears in our catalog under these names: 3,5,7,8-Tetrachloroperfluorooctanoic acid, 95%, 3,5,7,8-Tetrachloro-2,2,3,4,4,5,6,6,7,8,8-undecafluorooctanoic acid 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3,5,7,8-tetrachloro-2,2,3,4,4,5,6,6,7,8,8-undecafluorooctanoic acid (CAS 2923-68-4) is a chemical compound with the molecular formula C8HCl4F11O2 and a molecular weight of 479.9 g/mol. IUPAC name: 3,5,7,8-tetrachloro-2,2,3,4,4,5,6,6,7,8,8-undecafluorooctanoic acid. InChIKey: YSPJDMQUTGFRFK-UHFFFAOYSA-N.

Identity
Molecular formulaC8HCl4F11O2
Molecular weight479.9 g/mol
IUPAC name3,5,7,8-tetrachloro-2,2,3,4,4,5,6,6,7,8,8-undecafluorooctanoic acid
InChIKeyYSPJDMQUTGFRFK-UHFFFAOYSA-N
SMILESC(=O)(C(C(C(C(C(C(C(F)(F)Cl)(F)Cl)(F)F)(F)Cl)(F)F)(F)Cl)(F)F)O

Computed by PubChem (NCBI)