CAS 2923-68-4 appears in our catalog under these names: 3,5,7,8-Tetrachloroperfluorooctanoic acid, 95%, 3,5,7,8-Tetrachloro-2,2,3,4,4,5,6,6,7,8,8-undecafluorooctanoic acid 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 250mg.
3,5,7,8-tetrachloro-2,2,3,4,4,5,6,6,7,8,8-undecafluorooctanoic acid (CAS 2923-68-4) is a chemical compound with the molecular formula C8HCl4F11O2 and a molecular weight of 479.9 g/mol. IUPAC name: 3,5,7,8-tetrachloro-2,2,3,4,4,5,6,6,7,8,8-undecafluorooctanoic acid. InChIKey: YSPJDMQUTGFRFK-UHFFFAOYSA-N.
| Molecular formula | C8HCl4F11O2 |
|---|---|
| Molecular weight | 479.9 g/mol |
| IUPAC name | 3,5,7,8-tetrachloro-2,2,3,4,4,5,6,6,7,8,8-undecafluorooctanoic acid |
| InChIKey | YSPJDMQUTGFRFK-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(C(C(F)(F)Cl)(F)Cl)(F)F)(F)Cl)(F)F)(F)Cl)(F)F)O |
Computed by PubChem (NCBI)