CAS 2923008-44-8 appears in our catalog under these names: WRN inhibitor 1, WRN inhibitor 1, 98.05%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25 mg, 1 mg, 5 mg, 10 mg.
N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-6-(4-fluorophenyl)-2-oxo-1H-pyridine-3-carboxamide (CAS 2923008-44-8) is a chemical compound with the molecular formula C16H13FN2O4S and a molecular weight of 348.4 g/mol. IUPAC name: N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-6-(4-fluorophenyl)-2-oxo-1H-pyridine-3-carboxamide. InChIKey: YRGBNIIHHNVNDL-UHFFFAOYSA-N.
| Molecular formula | C16H13FN2O4S |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-6-(4-fluorophenyl)-2-oxo-1H-pyridine-3-carboxamide |
| InChIKey | YRGBNIIHHNVNDL-UHFFFAOYSA-N |
| SMILES | C1C(C=CS1(=O)=O)NC(=O)C2=CC=C(NC2=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)