CAS 2923009-95-2 appears in our catalog under these names: WRN inhibitor 5, WRN inhibitor 5, 98.12%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 10mM (in 1ml dmso), 100 mg, 5 mg, 25 mg, 10 mg, 50 mg.
N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-5-hydroxy-2-oxo-6-(2-phenylmethoxyphenyl)-1H-pyridine-3-carboxamide (CAS 2923009-95-2) is a chemical compound with the molecular formula C23H20N2O6S and a molecular weight of 452.5 g/mol. IUPAC name: N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-5-hydroxy-2-oxo-6-(2-phenylmethoxyphenyl)-1H-pyridine-3-carboxamide. InChIKey: UATCHQZLFRSLIK-MRXNPFEDSA-N.
| Molecular formula | C23H20N2O6S |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-5-hydroxy-2-oxo-6-(2-phenylmethoxyphenyl)-1H-pyridine-3-carboxamide |
| InChIKey | UATCHQZLFRSLIK-MRXNPFEDSA-N |
| SMILES | C1[C@@H](C=CS1(=O)=O)NC(=O)C2=CC(=C(NC2=O)C3=CC=CC=C3OCC4=CC=CC=C4)O |
Computed by PubChem (NCBI)