CAS 2923011-64-5 is the registry number for (R)-3-Amino-5-methyl-2,3-dihydrothiophene 1,1-dioxide hydrobromide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-5-methyl-1,1-dioxo-2,3-dihydrothiophen-3-amine;hydrobromide (CAS 2923011-64-5) is a chemical compound with the molecular formula C5H10BrNO2S and a molecular weight of 228.11 g/mol. IUPAC name: (3R)-5-methyl-1,1-dioxo-2,3-dihydrothiophen-3-amine;hydrobromide. InChIKey: ACJWDLINKDAMFM-NUBCRITNSA-N.
| Molecular formula | C5H10BrNO2S |
|---|---|
| Molecular weight | 228.11 g/mol |
| IUPAC name | (3R)-5-methyl-1,1-dioxo-2,3-dihydrothiophen-3-amine;hydrobromide |
| InChIKey | ACJWDLINKDAMFM-NUBCRITNSA-N |
| SMILES | CC1=C[C@H](CS1(=O)=O)N.Br |
Computed by PubChem (NCBI)