CAS 2923221-56-9 is the registry number for Lomonitinib. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(3,4-dimethoxyphenyl)-1-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrazolo[4,5-c]quinoline (CAS 2923221-56-9) is a chemical compound with the molecular formula C27H24N4O2 and a molecular weight of 436.5 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)-1-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrazolo[4,5-c]quinoline. InChIKey: AAIAGDXMETYTJE-UHFFFAOYSA-N.
| Molecular formula | C27H24N4O2 |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)-1-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrazolo[4,5-c]quinoline |
| InChIKey | AAIAGDXMETYTJE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NN(C3=C2C=NC4=CC=CC=C43)C5=CC6=C(CCNC6)C=C5)OC |
Computed by PubChem (NCBI)