Products 2923238-78-0
CAS 2923238-78-0 is the registry number for 8-Boc-1-methyl-2,8-diazaspiro[4.5]decan-3-one, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl 1-methyl-3-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate (CAS 2923238-78-0) is a chemical compound with the molecular formula C14H24N2O3 and a molecular weight of 268.35 g/mol. IUPAC name: tert-butyl 1-methyl-3-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate. InChIKey: XURSNIYHUCANLK-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O3 |
|---|---|
| Molecular weight | 268.35 g/mol |
| IUPAC name | tert-butyl 1-methyl-3-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
| InChIKey | XURSNIYHUCANLK-UHFFFAOYSA-N |
| SMILES | CC1C2(CCN(CC2)C(=O)OC(C)(C)C)CC(=O)N1 |
Computed by PubChem (NCBI)