CAS 2923335-54-8 is the registry number for 6,7-Dichloro-1,3,4,9-tetrahydro-[1,2,6]thiadiazino[4,3-g]indole 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dichloro-1,3,4,9-tetrahydropyrrolo[3,2-h][2,1,3]benzothiadiazine 2,2-dioxide (CAS 2923335-54-8) is a chemical compound with the molecular formula C9H7Cl2N3O2S and a molecular weight of 292.14 g/mol. IUPAC name: 6,7-dichloro-1,3,4,9-tetrahydropyrrolo[3,2-h][2,1,3]benzothiadiazine 2,2-dioxide. InChIKey: TZHUVNNZWYLDDN-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3O2S |
|---|---|
| Molecular weight | 292.14 g/mol |
| IUPAC name | 6,7-dichloro-1,3,4,9-tetrahydropyrrolo[3,2-h][2,1,3]benzothiadiazine 2,2-dioxide |
| InChIKey | TZHUVNNZWYLDDN-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C3C(=CNC3=C2NS(=O)(=O)N1)Cl)Cl |
Computed by PubChem (NCBI)